About S-benzoylsulfanyl benzenecarbothioate
S-benzoylsulfanyl benzenecarbothioate (PubChem CID 12569) has the molecular formula C14H10O2S2
and a molecular weight of 274.37 g/mol. Its IUPAC name is S-benzoylsulfanyl benzenecarbothioate.
Molecular Properties
| Compound Name | S-benzoylsulfanyl benzenecarbothioate |
| PubChem CID | 12569 |
| Molecular Formula | C14H10O2S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | S-benzoylsulfanyl benzenecarbothioate |
| SMILES | O=C(SSC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10O2S2/c15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12/h1-10H |
| InChIKey | YYWLHHUMIIIZDH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-benzoylsulfanyl benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-benzoylsulfanyl benzenecarbothioate?
The IUPAC name of S-benzoylsulfanyl benzenecarbothioate (CID 12569) is S-benzoylsulfanyl benzenecarbothioate.
What is the SMILES notation for S-benzoylsulfanyl benzenecarbothioate?
The canonical SMILES for S-benzoylsulfanyl benzenecarbothioate is O=C(SSC(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of S-benzoylsulfanyl benzenecarbothioate?
The InChIKey is YYWLHHUMIIIZDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O2S2/c15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12/h1-10H.
What are the key properties of S-benzoylsulfanyl benzenecarbothioate?
S-benzoylsulfanyl benzenecarbothioate has a molecular weight of 274.37 g/mol, XLogP of 4.05, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-benzoylsulfanyl benzenecarbothioate is sourced from PubChem (CID 12569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).