C9H6FN3O2 — CID 12569252
2-(4-fluorophenyl)-1,2,4-triazine-3,5-dione (PubChem CID 12569252) has the molecular formula C9H6FN3O2 and a molecular weight of 207.16 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1,2,4-triazine-3,5-dione.
| Compound Name | 2-(4-fluorophenyl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 12569252 |
| Molecular Formula | C9H6FN3O2 |
| Molecular Weight | 207.16 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 2-(4-fluorophenyl)-1,2,4-triazine-3,5-dione |
| SMILES | O=c1cnn(-c2ccc(F)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H6FN3O2/c10-6-1-3-7(4-2-6)13-9(15)12-8(14)5-11-13/h1-5H,(H,12,14,15) |
| InChIKey | BCCCORLYWTXIHP-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.16 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |