C9H4Cl3N3O2 — CID 12569259
2-(3,4,5-trichlorophenyl)-1,2,4-triazine-3,5-dione (PubChem CID 12569259) has the molecular formula C9H4Cl3N3O2 and a molecular weight of 292.51 g/mol. Its IUPAC name is 2-(3,4,5-trichlorophenyl)-1,2,4-triazine-3,5-dione.
| Compound Name | 2-(3,4,5-trichlorophenyl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 12569259 |
| Molecular Formula | C9H4Cl3N3O2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 290.94 |
| IUPAC Name | 2-(3,4,5-trichlorophenyl)-1,2,4-triazine-3,5-dione |
| SMILES | O=c1cnn(-c2cc(Cl)c(Cl)c(Cl)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H4Cl3N3O2/c10-5-1-4(2-6(11)8(5)12)15-9(17)14-7(16)3-13-15/h1-3H,(H,14,16,17) |
| InChIKey | HIZKOAOSMLFPFK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|