C10H5F4N3O2 — CID 12569272
2-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 12569272) has the molecular formula C10H5F4N3O2 and a molecular weight of 275.16 g/mol. Its IUPAC name is 2-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 12569272 |
| Molecular Formula | C10H5F4N3O2 |
| Molecular Weight | 275.16 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 2-[4-fluoro-3-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | O=c1cnn(-c2ccc(F)c(C(F)(F)F)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H5F4N3O2/c11-7-2-1-5(3-6(7)10(12,13)14)17-9(19)16-8(18)4-15-17/h1-4H,(H,16,18,19) |
| InChIKey | DSQFSJLZYZNHAA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.16 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |