C12H13N3O5 — CID 12569278
2-(3,4,5-trimethoxyphenyl)-1,2,4-triazine-3,5-dione (PubChem CID 12569278) has the molecular formula C12H13N3O5 and a molecular weight of 279.25 g/mol. Its IUPAC name is 2-(3,4,5-trimethoxyphenyl)-1,2,4-triazine-3,5-dione.
| Compound Name | 2-(3,4,5-trimethoxyphenyl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 12569278 |
| Molecular Formula | C12H13N3O5 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-(3,4,5-trimethoxyphenyl)-1,2,4-triazine-3,5-dione |
| SMILES | COc1cc(-n2ncc(=O)[nH]c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C12H13N3O5/c1-18-8-4-7(5-9(19-2)11(8)20-3)15-12(17)14-10(16)6-13-15/h4-6H,1-3H3,(H,14,16,17) |
| InChIKey | QCSHNQQVKAWNSS-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |