C9H5N5O6 — CID 12569281
2-(3,5-dinitrophenyl)-1,2,4-triazine-3,5-dione (PubChem CID 12569281) has the molecular formula C9H5N5O6 and a molecular weight of 279.17 g/mol. Its IUPAC name is 2-(3,5-dinitrophenyl)-1,2,4-triazine-3,5-dione.
| Compound Name | 2-(3,5-dinitrophenyl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 12569281 |
| Molecular Formula | C9H5N5O6 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 2-(3,5-dinitrophenyl)-1,2,4-triazine-3,5-dione |
| SMILES | O=c1cnn(-c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H5N5O6/c15-8-4-10-12(9(16)11-8)5-1-6(13(17)18)3-7(2-5)14(19)20/h1-4H,(H,11,15,16) |
| InChIKey | XASYGZUPLWQLIT-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 154.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|