C10H6F3N3O2 — CID 12569292
2-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 12569292) has the molecular formula C10H6F3N3O2 and a molecular weight of 257.17 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 12569292 |
| Molecular Formula | C10H6F3N3O2 |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | O=c1cnn(-c2cccc(C(F)(F)F)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H6F3N3O2/c11-10(12,13)6-2-1-3-7(4-6)16-9(18)15-8(17)5-14-16/h1-5H,(H,15,17,18) |
| InChIKey | FMKIHCNDKDAITD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |