About N,1-bis(2,4-dimethylphenyl)tetrazol-5-amine
N,1-bis(2,4-dimethylphenyl)tetrazol-5-amine (PubChem CID 12569677) has the molecular formula C17H19N5
and a molecular weight of 293.37 g/mol. Its IUPAC name is N,1-bis(2,4-dimethylphenyl)tetrazol-5-amine.
Molecular Properties
| Compound Name | N,1-bis(2,4-dimethylphenyl)tetrazol-5-amine |
| PubChem CID | 12569677 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N,1-bis(2,4-dimethylphenyl)tetrazol-5-amine |
| SMILES | Cc1ccc(Nc2nnnn2-c2ccc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C17H19N5/c1-11-5-7-15(13(3)9-11)18-17-19-20-21-22(17)16-8-6-12(2)10-14(16)4/h5-10H,1-4H3,(H,18,19,21) |
| InChIKey | BPFCXDUVIPOWHY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,1-bis(2,4-dimethylphenyl)tetrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-bis(2,4-dimethylphenyl)tetrazol-5-amine?
The IUPAC name of N,1-bis(2,4-dimethylphenyl)tetrazol-5-amine (CID 12569677) is N,1-bis(2,4-dimethylphenyl)tetrazol-5-amine.
What is the SMILES notation for N,1-bis(2,4-dimethylphenyl)tetrazol-5-amine?
The canonical SMILES for N,1-bis(2,4-dimethylphenyl)tetrazol-5-amine is Cc1ccc(Nc2nnnn2-c2ccc(C)cc2C)c(C)c1.
What is the InChIKey of N,1-bis(2,4-dimethylphenyl)tetrazol-5-amine?
The InChIKey is BPFCXDUVIPOWHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5/c1-11-5-7-15(13(3)9-11)18-17-19-20-21-22(17)16-8-6-12(2)10-14(16)4/h5-10H,1-4H3,(H,18,19,21).
What are the key properties of N,1-bis(2,4-dimethylphenyl)tetrazol-5-amine?
N,1-bis(2,4-dimethylphenyl)tetrazol-5-amine has a molecular weight of 293.37 g/mol, XLogP of 3.64, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-bis(2,4-dimethylphenyl)tetrazol-5-amine is sourced from PubChem (CID 12569677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).