About 1-hydroxy-3,5-dimethylpyrazole
1-hydroxy-3,5-dimethylpyrazole (PubChem CID 12569725) has the molecular formula C5H8N2O
and a molecular weight of 112.13 g/mol. Its IUPAC name is 1-hydroxy-3,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 1-hydroxy-3,5-dimethylpyrazole |
| PubChem CID | 12569725 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | 1-hydroxy-3,5-dimethylpyrazole |
| SMILES | Cc1cc(C)n(O)n1 |
| InChI | InChI=1S/C5H8N2O/c1-4-3-5(2)7(8)6-4/h3,8H,1-2H3 |
| InChIKey | RSNGJKZZJHQZAP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-3,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3,5-dimethylpyrazole?
The IUPAC name of 1-hydroxy-3,5-dimethylpyrazole (CID 12569725) is 1-hydroxy-3,5-dimethylpyrazole.
What is the SMILES notation for 1-hydroxy-3,5-dimethylpyrazole?
The canonical SMILES for 1-hydroxy-3,5-dimethylpyrazole is Cc1cc(C)n(O)n1.
What is the InChIKey of 1-hydroxy-3,5-dimethylpyrazole?
The InChIKey is RSNGJKZZJHQZAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O/c1-4-3-5(2)7(8)6-4/h3,8H,1-2H3.
What are the key properties of 1-hydroxy-3,5-dimethylpyrazole?
1-hydroxy-3,5-dimethylpyrazole has a molecular weight of 112.13 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3,5-dimethylpyrazole is sourced from PubChem (CID 12569725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).