C22H17BrN4O3S — CID 1256976
6-bromo-2-pyridin-3-yl-N-[(4-sulfamoylphenyl)methyl]quinoline-4-carboxamide (PubChem CID 1256976) has the molecular formula C22H17BrN4O3S and a molecular weight of 497.37 g/mol. Its IUPAC name is 6-bromo-2-pyridin-3-yl-N-[(4-sulfamoylphenyl)methyl]quinoline-4-carboxamide.
| Compound Name | 6-bromo-2-pyridin-3-yl-N-[(4-sulfamoylphenyl)methyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 1256976 |
| Molecular Formula | C22H17BrN4O3S |
| Molecular Weight | 497.37 g/mol |
| Exact Mass | 496.02 |
| IUPAC Name | 6-bromo-2-pyridin-3-yl-N-[(4-sulfamoylphenyl)methyl]quinoline-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)c2cc(-c3cccnc3)nc3ccc(Br)cc23)cc1 |
| InChI | InChI=1S/C22H17BrN4O3S/c23-16-5-8-20-18(10-16)19(11-21(27-20)15-2-1-9-25-13-15)22(28)26-12-14-3-6-17(7-4-14)31(24,29)30/h1-11,13H,12H2,(H,26,28)(H2,24,29,30) |
| InChIKey | DTJUYNPPFXNTJN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |