C10H23BO2Si — CID 12569882
trimethyl-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silane (PubChem CID 12569882) has the molecular formula C10H23BO2Si and a molecular weight of 214.19 g/mol. Its IUPAC name is trimethyl-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silane.
| Compound Name | trimethyl-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silane |
|---|---|
| PubChem CID | 12569882 |
| Molecular Formula | C10H23BO2Si |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | trimethyl-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silane |
| SMILES | CC1(C)OB(C[Si](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C10H23BO2Si/c1-9(2)10(3,4)13-11(12-9)8-14(5,6)7/h8H2,1-7H3 |
| InChIKey | ROVMHMGRSYLCTP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|