About (3-phenyl-1,2,4-oxadiazol-5-yl)methanol
(3-phenyl-1,2,4-oxadiazol-5-yl)methanol (PubChem CID 12569958) has the molecular formula C9H8N2O2
and a molecular weight of 176.17 g/mol. Its IUPAC name is (3-phenyl-1,2,4-oxadiazol-5-yl)methanol.
Molecular Properties
| Compound Name | (3-phenyl-1,2,4-oxadiazol-5-yl)methanol |
| PubChem CID | 12569958 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | (3-phenyl-1,2,4-oxadiazol-5-yl)methanol |
| SMILES | OCc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C9H8N2O2/c12-6-8-10-9(11-13-8)7-4-2-1-3-5-7/h1-5,12H,6H2 |
| InChIKey | NOIRXFZFSPXHIM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-phenyl-1,2,4-oxadiazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenyl-1,2,4-oxadiazol-5-yl)methanol?
The IUPAC name of (3-phenyl-1,2,4-oxadiazol-5-yl)methanol (CID 12569958) is (3-phenyl-1,2,4-oxadiazol-5-yl)methanol.
What is the SMILES notation for (3-phenyl-1,2,4-oxadiazol-5-yl)methanol?
The canonical SMILES for (3-phenyl-1,2,4-oxadiazol-5-yl)methanol is OCc1nc(-c2ccccc2)no1.
What is the InChIKey of (3-phenyl-1,2,4-oxadiazol-5-yl)methanol?
The InChIKey is NOIRXFZFSPXHIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c12-6-8-10-9(11-13-8)7-4-2-1-3-5-7/h1-5,12H,6H2.
What are the key properties of (3-phenyl-1,2,4-oxadiazol-5-yl)methanol?
(3-phenyl-1,2,4-oxadiazol-5-yl)methanol has a molecular weight of 176.17 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenyl-1,2,4-oxadiazol-5-yl)methanol is sourced from PubChem (CID 12569958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).