About (5-phenyl-1,2,4-oxadiazol-3-yl)methanediol
(5-phenyl-1,2,4-oxadiazol-3-yl)methanediol (PubChem CID 12569999) has the molecular formula C9H8N2O3
and a molecular weight of 192.17 g/mol. Its IUPAC name is (5-phenyl-1,2,4-oxadiazol-3-yl)methanediol.
Molecular Properties
| Compound Name | (5-phenyl-1,2,4-oxadiazol-3-yl)methanediol |
| PubChem CID | 12569999 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | (5-phenyl-1,2,4-oxadiazol-3-yl)methanediol |
| SMILES | OC(O)c1noc(-c2ccccc2)n1 |
| InChI | InChI=1S/C9H8N2O3/c12-9(13)7-10-8(14-11-7)6-4-2-1-3-5-6/h1-5,9,12-13H |
| InChIKey | PWVUAKNWLYSEPY-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (5-phenyl-1,2,4-oxadiazol-3-yl)methanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-phenyl-1,2,4-oxadiazol-3-yl)methanediol?
The IUPAC name of (5-phenyl-1,2,4-oxadiazol-3-yl)methanediol (CID 12569999) is (5-phenyl-1,2,4-oxadiazol-3-yl)methanediol.
What is the SMILES notation for (5-phenyl-1,2,4-oxadiazol-3-yl)methanediol?
The canonical SMILES for (5-phenyl-1,2,4-oxadiazol-3-yl)methanediol is OC(O)c1noc(-c2ccccc2)n1.
What is the InChIKey of (5-phenyl-1,2,4-oxadiazol-3-yl)methanediol?
The InChIKey is PWVUAKNWLYSEPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3/c12-9(13)7-10-8(14-11-7)6-4-2-1-3-5-6/h1-5,9,12-13H.
What are the key properties of (5-phenyl-1,2,4-oxadiazol-3-yl)methanediol?
(5-phenyl-1,2,4-oxadiazol-3-yl)methanediol has a molecular weight of 192.17 g/mol, XLogP of 0.72, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-phenyl-1,2,4-oxadiazol-3-yl)methanediol is sourced from PubChem (CID 12569999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).