C7H9N3O4 — CID 12570030
2-(methoxymethyl)-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole (PubChem CID 12570030) has the molecular formula C7H9N3O4 and a molecular weight of 199.17 g/mol. Its IUPAC name is 2-(methoxymethyl)-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole.
| Compound Name | 2-(methoxymethyl)-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 12570030 |
| Molecular Formula | C7H9N3O4 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 2-(methoxymethyl)-6-nitro-2,3-dihydroimidazo[2,1-b][1,3]oxazole |
| SMILES | COCC1Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C7H9N3O4/c1-13-4-5-2-9-3-6(10(11)12)8-7(9)14-5/h3,5H,2,4H2,1H3 |
| InChIKey | WPUARJMRQQUYAY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|