C8H9NO4S — CID 12570924
4,4-dioxo-4lambda6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione (PubChem CID 12570924) has the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. Its IUPAC name is 4,4-dioxo-4lambda6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione.
| Compound Name | 4,4-dioxo-4lambda6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione |
|---|---|
| PubChem CID | 12570924 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 4,4-dioxo-4lambda6-thia-9-azatricyclo[5.3.0.02,6]decane-8,10-dione |
| SMILES | O=C1NC(=O)C2C3CS(=O)(=O)CC3C12 |
| InChI | InChI=1S/C8H9NO4S/c10-7-5-3-1-14(12,13)2-4(3)6(5)8(11)9-7/h3-6H,1-2H2,(H,9,10,11) |
| InChIKey | VKADSJHOPGIVBW-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|