C10H9ClN4S — CID 12571204
4-(2-chlorophenyl)-6-methylsulfanyl-1,3,5-triazin-2-amine (PubChem CID 12571204) has the molecular formula C10H9ClN4S and a molecular weight of 252.73 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-6-methylsulfanyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(2-chlorophenyl)-6-methylsulfanyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 12571204 |
| Molecular Formula | C10H9ClN4S |
| Molecular Weight | 252.73 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 4-(2-chlorophenyl)-6-methylsulfanyl-1,3,5-triazin-2-amine |
| SMILES | CSc1nc(N)nc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C10H9ClN4S/c1-16-10-14-8(13-9(12)15-10)6-4-2-3-5-7(6)11/h2-5H,1H3,(H2,12,13,14,15) |
| InChIKey | JVOIPLKVZOLUDL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.73 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |