About 4-amino-1,3-dimethylimidazole-2-thione
4-amino-1,3-dimethylimidazole-2-thione (PubChem CID 12571560) has the molecular formula C5H9N3S
and a molecular weight of 143.21 g/mol. Its IUPAC name is 4-amino-1,3-dimethylimidazole-2-thione.
Molecular Properties
| Compound Name | 4-amino-1,3-dimethylimidazole-2-thione |
| PubChem CID | 12571560 |
| Molecular Formula | C5H9N3S |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 4-amino-1,3-dimethylimidazole-2-thione |
| SMILES | Cn1cc(N)n(C)c1=S |
| InChI | InChI=1S/C5H9N3S/c1-7-3-4(6)8(2)5(7)9/h3H,6H2,1-2H3 |
| InChIKey | FILNVQFDAMGPOQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1,3-dimethylimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,3-dimethylimidazole-2-thione?
The IUPAC name of 4-amino-1,3-dimethylimidazole-2-thione (CID 12571560) is 4-amino-1,3-dimethylimidazole-2-thione.
What is the SMILES notation for 4-amino-1,3-dimethylimidazole-2-thione?
The canonical SMILES for 4-amino-1,3-dimethylimidazole-2-thione is Cn1cc(N)n(C)c1=S.
What is the InChIKey of 4-amino-1,3-dimethylimidazole-2-thione?
The InChIKey is FILNVQFDAMGPOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3S/c1-7-3-4(6)8(2)5(7)9/h3H,6H2,1-2H3.
What are the key properties of 4-amino-1,3-dimethylimidazole-2-thione?
4-amino-1,3-dimethylimidazole-2-thione has a molecular weight of 143.21 g/mol, XLogP of 0.68, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,3-dimethylimidazole-2-thione is sourced from PubChem (CID 12571560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).