About 4-imino-1,3-dimethylimidazolidin-2-one
4-imino-1,3-dimethylimidazolidin-2-one (PubChem CID 12571568) has the molecular formula C5H9N3O
and a molecular weight of 127.15 g/mol. Its IUPAC name is 4-imino-1,3-dimethylimidazolidin-2-one.
Molecular Properties
| Compound Name | 4-imino-1,3-dimethylimidazolidin-2-one |
| PubChem CID | 12571568 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | 4-imino-1,3-dimethylimidazolidin-2-one |
| SMILES | [H]/N=C1\CN(C)C(=O)N1C |
| InChI | InChI=1S/C5H9N3O/c1-7-3-4(6)8(2)5(7)9/h6H,3H2,1-2H3/b6-4+ |
| InChIKey | HSGJWDKNQOLPLE-GQCTYLIASA-N |
| XLogP | -0.04 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-imino-1,3-dimethylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imino-1,3-dimethylimidazolidin-2-one?
The IUPAC name of 4-imino-1,3-dimethylimidazolidin-2-one (CID 12571568) is 4-imino-1,3-dimethylimidazolidin-2-one.
What is the SMILES notation for 4-imino-1,3-dimethylimidazolidin-2-one?
The canonical SMILES for 4-imino-1,3-dimethylimidazolidin-2-one is [H]/N=C1\CN(C)C(=O)N1C.
What is the InChIKey of 4-imino-1,3-dimethylimidazolidin-2-one?
The InChIKey is HSGJWDKNQOLPLE-GQCTYLIASA-N. The full InChI is InChI=1S/C5H9N3O/c1-7-3-4(6)8(2)5(7)9/h6H,3H2,1-2H3/b6-4+.
What are the key properties of 4-imino-1,3-dimethylimidazolidin-2-one?
4-imino-1,3-dimethylimidazolidin-2-one has a molecular weight of 127.15 g/mol, XLogP of -0.04, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imino-1,3-dimethylimidazolidin-2-one is sourced from PubChem (CID 12571568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).