About 7,8-dimethoxy-2-methyl-2,3-dihydrocyclopenta[a]naphthalen-1-one
7,8-dimethoxy-2-methyl-2,3-dihydrocyclopenta[a]naphthalen-1-one (PubChem CID 12571694) has the molecular formula C16H16O3
and a molecular weight of 256.30 g/mol. Its IUPAC name is 7,8-dimethoxy-2-methyl-2,3-dihydrocyclopenta[a]naphthalen-1-one.
Molecular Properties
| Compound Name | 7,8-dimethoxy-2-methyl-2,3-dihydrocyclopenta[a]naphthalen-1-one |
| PubChem CID | 12571694 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 7,8-dimethoxy-2-methyl-2,3-dihydrocyclopenta[a]naphthalen-1-one |
| SMILES | COc1cc2ccc3c(c2cc1OC)C(=O)C(C)C3 |
| InChI | InChI=1S/C16H16O3/c1-9-6-11-5-4-10-7-13(18-2)14(19-3)8-12(10)15(11)16(9)17/h4-5,7-9H,6H2,1-3H3 |
| InChIKey | XXRNNWHFXFZNOZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,8-dimethoxy-2-methyl-2,3-dihydrocyclopenta[a]naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethoxy-2-methyl-2,3-dihydrocyclopenta[a]naphthalen-1-one?
The IUPAC name of 7,8-dimethoxy-2-methyl-2,3-dihydrocyclopenta[a]naphthalen-1-one (CID 12571694) is 7,8-dimethoxy-2-methyl-2,3-dihydrocyclopenta[a]naphthalen-1-one.
What is the SMILES notation for 7,8-dimethoxy-2-methyl-2,3-dihydrocyclopenta[a]naphthalen-1-one?
The canonical SMILES for 7,8-dimethoxy-2-methyl-2,3-dihydrocyclopenta[a]naphthalen-1-one is COc1cc2ccc3c(c2cc1OC)C(=O)C(C)C3.
What is the InChIKey of 7,8-dimethoxy-2-methyl-2,3-dihydrocyclopenta[a]naphthalen-1-one?
The InChIKey is XXRNNWHFXFZNOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O3/c1-9-6-11-5-4-10-7-13(18-2)14(19-3)8-12(10)15(11)16(9)17/h4-5,7-9H,6H2,1-3H3.
What are the key properties of 7,8-dimethoxy-2-methyl-2,3-dihydrocyclopenta[a]naphthalen-1-one?
7,8-dimethoxy-2-methyl-2,3-dihydrocyclopenta[a]naphthalen-1-one has a molecular weight of 256.30 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethoxy-2-methyl-2,3-dihydrocyclopenta[a]naphthalen-1-one is sourced from PubChem (CID 12571694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).