About 1-chloro-1-ethoxyethene
1-chloro-1-ethoxyethene (PubChem CID 12571889) has the molecular formula C4H7ClO
and a molecular weight of 106.55 g/mol. Its IUPAC name is 1-chloro-1-ethoxyethene.
Molecular Properties
| Compound Name | 1-chloro-1-ethoxyethene |
| PubChem CID | 12571889 |
| Molecular Formula | C4H7ClO |
| Molecular Weight | 106.55 g/mol |
| Exact Mass | 106.02 |
| IUPAC Name | 1-chloro-1-ethoxyethene |
| SMILES | C=C(Cl)OCC |
| InChI | InChI=1S/C4H7ClO/c1-3-6-4(2)5/h2-3H2,1H3 |
| InChIKey | HAZSOXTUZRFCEW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.55 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-1-ethoxyethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1-ethoxyethene?
The IUPAC name of 1-chloro-1-ethoxyethene (CID 12571889) is 1-chloro-1-ethoxyethene.
What is the SMILES notation for 1-chloro-1-ethoxyethene?
The canonical SMILES for 1-chloro-1-ethoxyethene is C=C(Cl)OCC.
What is the InChIKey of 1-chloro-1-ethoxyethene?
The InChIKey is HAZSOXTUZRFCEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7ClO/c1-3-6-4(2)5/h2-3H2,1H3.
What are the key properties of 1-chloro-1-ethoxyethene?
1-chloro-1-ethoxyethene has a molecular weight of 106.55 g/mol, XLogP of 1.73, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1-ethoxyethene is sourced from PubChem (CID 12571889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).