C13H2F8 — CID 12571901
1,2,3,4,5,6,7,8-octafluoro-9H-fluorene (PubChem CID 12571901) has the molecular formula C13H2F8 and a molecular weight of 310.14 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octafluoro-9H-fluorene.
| Compound Name | 1,2,3,4,5,6,7,8-octafluoro-9H-fluorene |
|---|---|
| PubChem CID | 12571901 |
| Molecular Formula | C13H2F8 |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octafluoro-9H-fluorene |
| SMILES | Fc1c(F)c(F)c2c(c1F)Cc1c(F)c(F)c(F)c(F)c1-2 |
| InChI | InChI=1S/C13H2F8/c14-6-2-1-3-5(4(2)8(16)12(20)10(6)18)9(17)13(21)11(19)7(3)15/h1H2 |
| InChIKey | HGNCDJPIGYRCMI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|