C14HF10N — CID 12571909
2,2-bis(2,3,4,5,6-pentafluorophenyl)acetonitrile (PubChem CID 12571909) has the molecular formula C14HF10N and a molecular weight of 373.15 g/mol. Its IUPAC name is 2,2-bis(2,3,4,5,6-pentafluorophenyl)acetonitrile.
| Compound Name | 2,2-bis(2,3,4,5,6-pentafluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 12571909 |
| Molecular Formula | C14HF10N |
| Molecular Weight | 373.15 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | 2,2-bis(2,3,4,5,6-pentafluorophenyl)acetonitrile |
| SMILES | N#CC(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14HF10N/c15-5-3(6(16)10(20)13(23)9(5)19)2(1-25)4-7(17)11(21)14(24)12(22)8(4)18/h2H |
| InChIKey | BARKWGOHPQXAPQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.15 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|