About 1-cyclopentyl-2,2-diethoxyethanone
1-cyclopentyl-2,2-diethoxyethanone (PubChem CID 12573299) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-cyclopentyl-2,2-diethoxyethanone.
Molecular Properties
| Compound Name | 1-cyclopentyl-2,2-diethoxyethanone |
| PubChem CID | 12573299 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 1-cyclopentyl-2,2-diethoxyethanone |
| SMILES | CCOC(OCC)C(=O)C1CCCC1 |
| InChI | InChI=1S/C11H20O3/c1-3-13-11(14-4-2)10(12)9-7-5-6-8-9/h9,11H,3-8H2,1-2H3 |
| InChIKey | IHBQXFOYQJOBQA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentyl-2,2-diethoxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-2,2-diethoxyethanone?
The IUPAC name of 1-cyclopentyl-2,2-diethoxyethanone (CID 12573299) is 1-cyclopentyl-2,2-diethoxyethanone.
What is the SMILES notation for 1-cyclopentyl-2,2-diethoxyethanone?
The canonical SMILES for 1-cyclopentyl-2,2-diethoxyethanone is CCOC(OCC)C(=O)C1CCCC1.
What is the InChIKey of 1-cyclopentyl-2,2-diethoxyethanone?
The InChIKey is IHBQXFOYQJOBQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-3-13-11(14-4-2)10(12)9-7-5-6-8-9/h9,11H,3-8H2,1-2H3.
What are the key properties of 1-cyclopentyl-2,2-diethoxyethanone?
1-cyclopentyl-2,2-diethoxyethanone has a molecular weight of 200.28 g/mol, XLogP of 2.14, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-2,2-diethoxyethanone is sourced from PubChem (CID 12573299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).