C8H24Si4 — CID 12573720
1,1,2,2,3,3,4,4-octamethyltetrasiletane (PubChem CID 12573720) has the molecular formula C8H24Si4 and a molecular weight of 232.62 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octamethyltetrasiletane.
| Compound Name | 1,1,2,2,3,3,4,4-octamethyltetrasiletane |
|---|---|
| PubChem CID | 12573720 |
| Molecular Formula | C8H24Si4 |
| Molecular Weight | 232.62 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octamethyltetrasiletane |
| SMILES | C[Si]1(C)[Si](C)(C)[Si](C)(C)[Si]1(C)C |
| InChI | InChI=1S/C8H24Si4/c1-9(2)10(3,4)12(7,8)11(9,5)6/h1-8H3 |
| InChIKey | NJECQESCCSENHG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.62 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|