About 6-(prop-2-enoxymethyl)-3-oxatricyclo[3.2.1.02,4]octane
6-(prop-2-enoxymethyl)-3-oxatricyclo[3.2.1.02,4]octane (PubChem CID 12574062) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 6-(prop-2-enoxymethyl)-3-oxatricyclo[3.2.1.02,4]octane.
Molecular Properties
| Compound Name | 6-(prop-2-enoxymethyl)-3-oxatricyclo[3.2.1.02,4]octane |
| PubChem CID | 12574062 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 6-(prop-2-enoxymethyl)-3-oxatricyclo[3.2.1.02,4]octane |
| SMILES | C=CCOCC1CC2CC1C1OC21 |
| InChI | InChI=1S/C11H16O2/c1-2-3-12-6-8-4-7-5-9(8)11-10(7)13-11/h2,7-11H,1,3-6H2 |
| InChIKey | YPBADIFOYBLAOB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6-(prop-2-enoxymethyl)-3-oxatricyclo[3.2.1.02,4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(prop-2-enoxymethyl)-3-oxatricyclo[3.2.1.02,4]octane?
The IUPAC name of 6-(prop-2-enoxymethyl)-3-oxatricyclo[3.2.1.02,4]octane (CID 12574062) is 6-(prop-2-enoxymethyl)-3-oxatricyclo[3.2.1.02,4]octane.
What is the SMILES notation for 6-(prop-2-enoxymethyl)-3-oxatricyclo[3.2.1.02,4]octane?
The canonical SMILES for 6-(prop-2-enoxymethyl)-3-oxatricyclo[3.2.1.02,4]octane is C=CCOCC1CC2CC1C1OC21.
What is the InChIKey of 6-(prop-2-enoxymethyl)-3-oxatricyclo[3.2.1.02,4]octane?
The InChIKey is YPBADIFOYBLAOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-2-3-12-6-8-4-7-5-9(8)11-10(7)13-11/h2,7-11H,1,3-6H2.
What are the key properties of 6-(prop-2-enoxymethyl)-3-oxatricyclo[3.2.1.02,4]octane?
6-(prop-2-enoxymethyl)-3-oxatricyclo[3.2.1.02,4]octane has a molecular weight of 180.25 g/mol, XLogP of 1.61, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(prop-2-enoxymethyl)-3-oxatricyclo[3.2.1.02,4]octane is sourced from PubChem (CID 12574062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).