C13H10F4O — CID 12574917
(1R,8S,9R)-3,4,5,6-tetrafluoro-9-methyltricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraen-9-ol (PubChem CID 12574917) has the molecular formula C13H10F4O and a molecular weight of 258.21 g/mol. Its IUPAC name is (1R,8S,9R)-3,4,5,6-tetrafluoro-9-methyltricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraen-9-ol.
| Compound Name | (1R,8S,9R)-3,4,5,6-tetrafluoro-9-methyltricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraen-9-ol |
|---|---|
| PubChem CID | 12574917 |
| Molecular Formula | C13H10F4O |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | (1R,8S,9R)-3,4,5,6-tetrafluoro-9-methyltricyclo[6.2.2.02,7]dodeca-2(7),3,5,11-tetraen-9-ol |
| SMILES | C[C@@]1(O)C[C@@H]2C=C[C@H]1c1c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C13H10F4O/c1-13(18)4-5-2-3-6(13)8-7(5)9(14)11(16)12(17)10(8)15/h2-3,5-6,18H,4H2,1H3/t5-,6-,13+/m0/s1 |
| InChIKey | YEFSYSGSHXJEPN-NJLOMBEFSA-N |
| XLogP | 3.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|