About gold(1+);8H-quinolin-8-ide
gold(1+);8H-quinolin-8-ide (PubChem CID 12575030) has the molecular formula C9H6AuN
and a molecular weight of 325.12 g/mol. Its IUPAC name is gold(1+);8H-quinolin-8-ide.
Molecular Properties
| Compound Name | gold(1+);8H-quinolin-8-ide |
| PubChem CID | 12575030 |
| Molecular Formula | C9H6AuN |
| Molecular Weight | 325.12 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | gold(1+);8H-quinolin-8-ide |
| SMILES | [Au+].[c-]1cccc2cccnc12 |
| InChI | InChI=1S/C9H6N.Au/c1-2-6-9-8(4-1)5-3-7-10-9;/h1-5,7H;/q-1;+1 |
| InChIKey | ROAVZKFYNSDLPC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.12 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze gold(1+);8H-quinolin-8-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold(1+);8H-quinolin-8-ide?
The IUPAC name of gold(1+);8H-quinolin-8-ide (CID 12575030) is gold(1+);8H-quinolin-8-ide.
What is the SMILES notation for gold(1+);8H-quinolin-8-ide?
The canonical SMILES for gold(1+);8H-quinolin-8-ide is [Au+].[c-]1cccc2cccnc12.
What is the InChIKey of gold(1+);8H-quinolin-8-ide?
The InChIKey is ROAVZKFYNSDLPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N.Au/c1-2-6-9-8(4-1)5-3-7-10-9;/h1-5,7H;/q-1;+1.
What are the key properties of gold(1+);8H-quinolin-8-ide?
gold(1+);8H-quinolin-8-ide has a molecular weight of 325.12 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for gold(1+);8H-quinolin-8-ide is sourced from PubChem (CID 12575030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).