C10H18S — CID 12575101
2,3-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene (PubChem CID 12575101) has the molecular formula C10H18S and a molecular weight of 170.32 g/mol. Its IUPAC name is 2,3-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene.
| Compound Name | 2,3-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene |
|---|---|
| PubChem CID | 12575101 |
| Molecular Formula | C10H18S |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2,3-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzothiophene |
| SMILES | CC1SC2CCCCC2C1C |
| InChI | InChI=1S/C10H18S/c1-7-8(2)11-10-6-4-3-5-9(7)10/h7-10H,3-6H2,1-2H3 |
| InChIKey | DYJZSXHIGGXDFY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |