About 2-cyclopenta-2,4-dien-1-ylidenepropan-1-ol
2-cyclopenta-2,4-dien-1-ylidenepropan-1-ol (PubChem CID 12575364) has the molecular formula C8H10O
and a molecular weight of 122.17 g/mol. Its IUPAC name is 2-cyclopenta-2,4-dien-1-ylidenepropan-1-ol.
Molecular Properties
| Compound Name | 2-cyclopenta-2,4-dien-1-ylidenepropan-1-ol |
| PubChem CID | 12575364 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 2-cyclopenta-2,4-dien-1-ylidenepropan-1-ol |
| SMILES | CC(CO)=C1C=CC=C1 |
| InChI | InChI=1S/C8H10O/c1-7(6-9)8-4-2-3-5-8/h2-5,9H,6H2,1H3 |
| InChIKey | CVKLGQQVZLIARX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopenta-2,4-dien-1-ylidenepropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopenta-2,4-dien-1-ylidenepropan-1-ol?
The IUPAC name of 2-cyclopenta-2,4-dien-1-ylidenepropan-1-ol (CID 12575364) is 2-cyclopenta-2,4-dien-1-ylidenepropan-1-ol.
What is the SMILES notation for 2-cyclopenta-2,4-dien-1-ylidenepropan-1-ol?
The canonical SMILES for 2-cyclopenta-2,4-dien-1-ylidenepropan-1-ol is CC(CO)=C1C=CC=C1.
What is the InChIKey of 2-cyclopenta-2,4-dien-1-ylidenepropan-1-ol?
The InChIKey is CVKLGQQVZLIARX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O/c1-7(6-9)8-4-2-3-5-8/h2-5,9H,6H2,1H3.
What are the key properties of 2-cyclopenta-2,4-dien-1-ylidenepropan-1-ol?
2-cyclopenta-2,4-dien-1-ylidenepropan-1-ol has a molecular weight of 122.17 g/mol, XLogP of 1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopenta-2,4-dien-1-ylidenepropan-1-ol is sourced from PubChem (CID 12575364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).