About S-(2-hydroxycyclohexyl) ethanethioate
S-(2-hydroxycyclohexyl) ethanethioate (PubChem CID 12575390) has the molecular formula C8H14O2S
and a molecular weight of 174.26 g/mol. Its IUPAC name is S-(2-hydroxycyclohexyl) ethanethioate.
Molecular Properties
| Compound Name | S-(2-hydroxycyclohexyl) ethanethioate |
| PubChem CID | 12575390 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | S-(2-hydroxycyclohexyl) ethanethioate |
| SMILES | CC(=O)SC1CCCCC1O |
| InChI | InChI=1S/C8H14O2S/c1-6(9)11-8-5-3-2-4-7(8)10/h7-8,10H,2-5H2,1H3 |
| InChIKey | DOEUXVVOVZPITF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-hydroxycyclohexyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-hydroxycyclohexyl) ethanethioate?
The IUPAC name of S-(2-hydroxycyclohexyl) ethanethioate (CID 12575390) is S-(2-hydroxycyclohexyl) ethanethioate.
What is the SMILES notation for S-(2-hydroxycyclohexyl) ethanethioate?
The canonical SMILES for S-(2-hydroxycyclohexyl) ethanethioate is CC(=O)SC1CCCCC1O.
What is the InChIKey of S-(2-hydroxycyclohexyl) ethanethioate?
The InChIKey is DOEUXVVOVZPITF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2S/c1-6(9)11-8-5-3-2-4-7(8)10/h7-8,10H,2-5H2,1H3.
What are the key properties of S-(2-hydroxycyclohexyl) ethanethioate?
S-(2-hydroxycyclohexyl) ethanethioate has a molecular weight of 174.26 g/mol, XLogP of 1.57, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-hydroxycyclohexyl) ethanethioate is sourced from PubChem (CID 12575390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).