About 2,6-dimethyl-4,5,6,7-tetrahydro-1,3-benzoxazole
2,6-dimethyl-4,5,6,7-tetrahydro-1,3-benzoxazole (PubChem CID 12575563) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 2,6-dimethyl-4,5,6,7-tetrahydro-1,3-benzoxazole.
Analyze 2,6-dimethyl-4,5,6,7-tetrahydro-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-4,5,6,7-tetrahydro-1,3-benzoxazole?
The IUPAC name of 2,6-dimethyl-4,5,6,7-tetrahydro-1,3-benzoxazole (CID 12575563) is 2,6-dimethyl-4,5,6,7-tetrahydro-1,3-benzoxazole.
What is the SMILES notation for 2,6-dimethyl-4,5,6,7-tetrahydro-1,3-benzoxazole?
The canonical SMILES for 2,6-dimethyl-4,5,6,7-tetrahydro-1,3-benzoxazole is Cc1nc2c(o1)CC(C)CC2.
What is the InChIKey of 2,6-dimethyl-4,5,6,7-tetrahydro-1,3-benzoxazole?
The InChIKey is KBILXTRHXHSRJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-6-3-4-8-9(5-6)11-7(2)10-8/h6H,3-5H2,1-2H3.
What are the key properties of 2,6-dimethyl-4,5,6,7-tetrahydro-1,3-benzoxazole?
2,6-dimethyl-4,5,6,7-tetrahydro-1,3-benzoxazole has a molecular weight of 151.21 g/mol, XLogP of 2.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-4,5,6,7-tetrahydro-1,3-benzoxazole is sourced from PubChem (CID 12575563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).