C21H31NO12S — CID 12575644
(2R,4S)-5,5-dimethyl-2-[(1R,2S,3S,4R)-1,2,3,4,5-pentaacetyloxypentyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 12575644) has the molecular formula C21H31NO12S and a molecular weight of 521.54 g/mol. Its IUPAC name is (2R,4S)-5,5-dimethyl-2-[(1R,2S,3S,4R)-1,2,3,4,5-pentaacetyloxypentyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2R,4S)-5,5-dimethyl-2-[(1R,2S,3S,4R)-1,2,3,4,5-pentaacetyloxypentyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 12575644 |
| Molecular Formula | C21H31NO12S |
| Molecular Weight | 521.54 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | (2R,4S)-5,5-dimethyl-2-[(1R,2S,3S,4R)-1,2,3,4,5-pentaacetyloxypentyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1N[C@@H](C(=O)O)C(C)(C)S1 |
| InChI | InChI=1S/C21H31NO12S/c1-9(23)30-8-14(31-10(2)24)15(32-11(3)25)16(33-12(4)26)17(34-13(5)27)19-22-18(20(28)29)21(6,7)35-19/h14-19,22H,8H2,1-7H3,(H,28,29)/t14-,15+,16+,17-,18+,19-/m1/s1 |
| InChIKey | GTNMWGHRDMSTAW-BPCAWRKVSA-N |
| XLogP | 0.17 |
| TPSA | 180.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.54 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|