C19H27NO12S — CID 12575653
2-(1,2,3,4,5-pentaacetyloxypentyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 12575653) has the molecular formula C19H27NO12S and a molecular weight of 493.49 g/mol. Its IUPAC name is 2-(1,2,3,4,5-pentaacetyloxypentyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-(1,2,3,4,5-pentaacetyloxypentyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 12575653 |
| Molecular Formula | C19H27NO12S |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 2-(1,2,3,4,5-pentaacetyloxypentyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1NC(C(=O)O)CS1 |
| InChI | InChI=1S/C19H27NO12S/c1-8(21)28-6-14(29-9(2)22)15(30-10(3)23)16(31-11(4)24)17(32-12(5)25)18-20-13(7-33-18)19(26)27/h13-18,20H,6-7H2,1-5H3,(H,26,27) |
| InChIKey | CKTVNLYWQOWHDU-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 180.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|