About 1,4-dibromohexane
1,4-dibromohexane (PubChem CID 12575820) has the molecular formula C6H12Br2
and a molecular weight of 243.97 g/mol. Its IUPAC name is 1,4-dibromohexane.
Molecular Properties
| Compound Name | 1,4-dibromohexane |
| PubChem CID | 12575820 |
| Molecular Formula | C6H12Br2 |
| Molecular Weight | 243.97 g/mol |
| Exact Mass | 241.93 |
| IUPAC Name | 1,4-dibromohexane |
| SMILES | CCC(Br)CCCBr |
| InChI | InChI=1S/C6H12Br2/c1-2-6(8)4-3-5-7/h6H,2-5H2,1H3 |
| InChIKey | PZPWGUJTIZXBKR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.97 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dibromohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dibromohexane?
The IUPAC name of 1,4-dibromohexane (CID 12575820) is 1,4-dibromohexane.
What is the SMILES notation for 1,4-dibromohexane?
The canonical SMILES for 1,4-dibromohexane is CCC(Br)CCCBr.
What is the InChIKey of 1,4-dibromohexane?
The InChIKey is PZPWGUJTIZXBKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12Br2/c1-2-6(8)4-3-5-7/h6H,2-5H2,1H3.
What are the key properties of 1,4-dibromohexane?
1,4-dibromohexane has a molecular weight of 243.97 g/mol, XLogP of 3.34, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dibromohexane is sourced from PubChem (CID 12575820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).