C20H19BrO — CID 12575937
(1Z,7E,9E,11Z)-10-bromo-8-[(2-methylpropan-2-yl)oxy]tricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 12575937) has the molecular formula C20H19BrO and a molecular weight of 355.28 g/mol. Its IUPAC name is (1Z,7E,9E,11Z)-10-bromo-8-[(2-methylpropan-2-yl)oxy]tricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | (1Z,7E,9E,11Z)-10-bromo-8-[(2-methylpropan-2-yl)oxy]tricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 12575937 |
| Molecular Formula | C20H19BrO |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | (1Z,7E,9E,11Z)-10-bromo-8-[(2-methylpropan-2-yl)oxy]tricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | CC(C)(C)OC1=c2\cccc\c2=c2/cccc/c2=C/C(Br)=C\1 |
| InChI | InChI=1S/C20H19BrO/c1-20(2,3)22-19-13-15(21)12-14-8-4-5-9-16(14)17-10-6-7-11-18(17)19/h4-13H,1-3H3/b14-12-,15-12+,15-13+,17-16-,19-13+,19-18+ |
| InChIKey | GYQGYHYNBWMOAH-AVKPJVSXSA-N |
| XLogP | 3.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |