About 2-bromobenzene-1,3,5-tricarbonitrile
2-bromobenzene-1,3,5-tricarbonitrile (PubChem CID 12575939) has the molecular formula C9H2BrN3
and a molecular weight of 232.04 g/mol. Its IUPAC name is 2-bromobenzene-1,3,5-tricarbonitrile.
Molecular Properties
| Compound Name | 2-bromobenzene-1,3,5-tricarbonitrile |
| PubChem CID | 12575939 |
| Molecular Formula | C9H2BrN3 |
| Molecular Weight | 232.04 g/mol |
| Exact Mass | 230.94 |
| IUPAC Name | 2-bromobenzene-1,3,5-tricarbonitrile |
| SMILES | N#Cc1cc(C#N)c(Br)c(C#N)c1 |
| InChI | InChI=1S/C9H2BrN3/c10-9-7(4-12)1-6(3-11)2-8(9)5-13/h1-2H |
| InChIKey | YGFVWIQIZSXGMH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.04 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromobenzene-1,3,5-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromobenzene-1,3,5-tricarbonitrile?
The IUPAC name of 2-bromobenzene-1,3,5-tricarbonitrile (CID 12575939) is 2-bromobenzene-1,3,5-tricarbonitrile.
What is the SMILES notation for 2-bromobenzene-1,3,5-tricarbonitrile?
The canonical SMILES for 2-bromobenzene-1,3,5-tricarbonitrile is N#Cc1cc(C#N)c(Br)c(C#N)c1.
What is the InChIKey of 2-bromobenzene-1,3,5-tricarbonitrile?
The InChIKey is YGFVWIQIZSXGMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H2BrN3/c10-9-7(4-12)1-6(3-11)2-8(9)5-13/h1-2H.
What are the key properties of 2-bromobenzene-1,3,5-tricarbonitrile?
2-bromobenzene-1,3,5-tricarbonitrile has a molecular weight of 232.04 g/mol, XLogP of 2.06, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromobenzene-1,3,5-tricarbonitrile is sourced from PubChem (CID 12575939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).