C11H13F3O — CID 12576065
4-(trifluoromethyl)-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one (PubChem CID 12576065) has the molecular formula C11H13F3O and a molecular weight of 218.22 g/mol. Its IUPAC name is 4-(trifluoromethyl)-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one.
| Compound Name | 4-(trifluoromethyl)-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 12576065 |
| Molecular Formula | C11H13F3O |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4-(trifluoromethyl)-3,4,5,6,7,8-hexahydro-1H-naphthalen-2-one |
| SMILES | O=C1CC2=C(CCCC2)C(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H13F3O/c12-11(13,14)10-6-8(15)5-7-3-1-2-4-9(7)10/h10H,1-6H2 |
| InChIKey | NITZAMBWLCCETH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|