C6H11N3 — CID 1257670
(2,5-dimethylpyrazol-3-yl)methanamine (PubChem CID 1257670) has the molecular formula C6H11N3 and a molecular weight of 125.17 g/mol. Its IUPAC name is (2,5-dimethylpyrazol-3-yl)methanamine.
| Compound Name | (2,5-dimethylpyrazol-3-yl)methanamine |
|---|---|
| PubChem CID | 1257670 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | (2,5-dimethylpyrazol-3-yl)methanamine |
| SMILES | Cc1cc(CN)n(C)n1 |
| InChI | InChI=1S/C6H11N3/c1-5-3-6(4-7)9(2)8-5/h3H,4,7H2,1-2H3 |
| InChIKey | DAOWQCXPMWGSBW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |