About 2-methylsulfanylbenzoyl chloride
2-methylsulfanylbenzoyl chloride (PubChem CID 12576798) has the molecular formula C8H7ClOS
and a molecular weight of 186.66 g/mol. Its IUPAC name is 2-methylsulfanylbenzoyl chloride.
Molecular Properties
| Compound Name | 2-methylsulfanylbenzoyl chloride |
| PubChem CID | 12576798 |
| Molecular Formula | C8H7ClOS |
| Molecular Weight | 186.66 g/mol |
| Exact Mass | 185.99 |
| IUPAC Name | 2-methylsulfanylbenzoyl chloride |
| SMILES | CSc1ccccc1C(=O)Cl |
| InChI | InChI=1S/C8H7ClOS/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5H,1H3 |
| InChIKey | AAWPBDPLOOSGGF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.66 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfanylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanylbenzoyl chloride?
The IUPAC name of 2-methylsulfanylbenzoyl chloride (CID 12576798) is 2-methylsulfanylbenzoyl chloride.
What is the SMILES notation for 2-methylsulfanylbenzoyl chloride?
The canonical SMILES for 2-methylsulfanylbenzoyl chloride is CSc1ccccc1C(=O)Cl.
What is the InChIKey of 2-methylsulfanylbenzoyl chloride?
The InChIKey is AAWPBDPLOOSGGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClOS/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5H,1H3.
What are the key properties of 2-methylsulfanylbenzoyl chloride?
2-methylsulfanylbenzoyl chloride has a molecular weight of 186.66 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylbenzoyl chloride is sourced from PubChem (CID 12576798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).