C10H10Cl4N2O — CID 12576949
2,2-dimethyl-N-[(2,3,4,5-tetrachlorocyclopenta-2,4-dien-1-ylidene)amino]propanamide (PubChem CID 12576949) has the molecular formula C10H10Cl4N2O and a molecular weight of 316.02 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(2,3,4,5-tetrachlorocyclopenta-2,4-dien-1-ylidene)amino]propanamide.
| Compound Name | 2,2-dimethyl-N-[(2,3,4,5-tetrachlorocyclopenta-2,4-dien-1-ylidene)amino]propanamide |
|---|---|
| PubChem CID | 12576949 |
| Molecular Formula | C10H10Cl4N2O |
| Molecular Weight | 316.02 g/mol |
| Exact Mass | 313.95 |
| IUPAC Name | 2,2-dimethyl-N-[(2,3,4,5-tetrachlorocyclopenta-2,4-dien-1-ylidene)amino]propanamide |
| SMILES | CC(C)(C)C(=O)NN=C1C(Cl)=C(Cl)C(Cl)=C1Cl |
| InChI | InChI=1S/C10H10Cl4N2O/c1-10(2,3)9(17)16-15-8-6(13)4(11)5(12)7(8)14/h1-3H3,(H,16,17) |
| InChIKey | VEJYKBVAEQYEKK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.02 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|