C12H6Cl4N2O — CID 12576957
N-[(2,3,4,5-tetrachlorocyclopenta-2,4-dien-1-ylidene)amino]benzamide (PubChem CID 12576957) has the molecular formula C12H6Cl4N2O and a molecular weight of 336.01 g/mol. Its IUPAC name is N-[(2,3,4,5-tetrachlorocyclopenta-2,4-dien-1-ylidene)amino]benzamide.
| Compound Name | N-[(2,3,4,5-tetrachlorocyclopenta-2,4-dien-1-ylidene)amino]benzamide |
|---|---|
| PubChem CID | 12576957 |
| Molecular Formula | C12H6Cl4N2O |
| Molecular Weight | 336.01 g/mol |
| Exact Mass | 333.92 |
| IUPAC Name | N-[(2,3,4,5-tetrachlorocyclopenta-2,4-dien-1-ylidene)amino]benzamide |
| SMILES | O=C(NN=C1C(Cl)=C(Cl)C(Cl)=C1Cl)c1ccccc1 |
| InChI | InChI=1S/C12H6Cl4N2O/c13-7-8(14)10(16)11(9(7)15)17-18-12(19)6-4-2-1-3-5-6/h1-5H,(H,18,19) |
| InChIKey | KQDNREGKNSEUSU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.01 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|