C10H9F3O2 — CID 12577274
(2,5-dimethylphenyl) 2,2,2-trifluoroacetate (PubChem CID 12577274) has the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. Its IUPAC name is (2,5-dimethylphenyl) 2,2,2-trifluoroacetate.
| Compound Name | (2,5-dimethylphenyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 12577274 |
| Molecular Formula | C10H9F3O2 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | (2,5-dimethylphenyl) 2,2,2-trifluoroacetate |
| SMILES | Cc1ccc(C)c(OC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9F3O2/c1-6-3-4-7(2)8(5-6)15-9(14)10(11,12)13/h3-5H,1-2H3 |
| InChIKey | IBFAGZLTLIKNMS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|