C10H16N2 — CID 12577375
2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-2-carbonitrile (PubChem CID 12577375) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-2-carbonitrile.
| Compound Name | 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-2-carbonitrile |
|---|---|
| PubChem CID | 12577375 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine-2-carbonitrile |
| SMILES | N#CC1CCN2CCCCC2C1 |
| InChI | InChI=1S/C10H16N2/c11-8-9-4-6-12-5-2-1-3-10(12)7-9/h9-10H,1-7H2 |
| InChIKey | WCMCVYJIALWOCA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |