About 4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]-2,6-dimethoxyphenol
4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]-2,6-dimethoxyphenol (PubChem CID 12577396) has the molecular formula C14H18N4O3
and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]-2,6-dimethoxyphenol.
Molecular Properties
| Compound Name | 4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]-2,6-dimethoxyphenol |
| PubChem CID | 12577396 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(Cc2c(C)nc(N)nc2N)cc(OC)c1O |
| InChI | InChI=1S/C14H18N4O3/c1-7-9(13(15)18-14(16)17-7)4-8-5-10(20-2)12(19)11(6-8)21-3/h5-6,19H,4H2,1-3H3,(H4,15,16,17,18) |
| InChIKey | OWESLNUTAHNAGR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 116.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]-2,6-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]-2,6-dimethoxyphenol?
The IUPAC name of 4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]-2,6-dimethoxyphenol (CID 12577396) is 4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]-2,6-dimethoxyphenol.
What is the SMILES notation for 4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]-2,6-dimethoxyphenol?
The canonical SMILES for 4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]-2,6-dimethoxyphenol is COc1cc(Cc2c(C)nc(N)nc2N)cc(OC)c1O.
What is the InChIKey of 4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]-2,6-dimethoxyphenol?
The InChIKey is OWESLNUTAHNAGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O3/c1-7-9(13(15)18-14(16)17-7)4-8-5-10(20-2)12(19)11(6-8)21-3/h5-6,19H,4H2,1-3H3,(H4,15,16,17,18).
What are the key properties of 4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]-2,6-dimethoxyphenol?
4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]-2,6-dimethoxyphenol has a molecular weight of 290.32 g/mol, XLogP of 1.26, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-diamino-6-methylpyrimidin-5-yl)methyl]-2,6-dimethoxyphenol is sourced from PubChem (CID 12577396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).