C17H11Cl2NO — CID 12577677
(3E)-3-benzylidene-5-(3,4-dichlorophenyl)-1H-pyrrol-2-one (PubChem CID 12577677) has the molecular formula C17H11Cl2NO and a molecular weight of 316.19 g/mol. Its IUPAC name is (3E)-3-benzylidene-5-(3,4-dichlorophenyl)-1H-pyrrol-2-one.
| Compound Name | (3E)-3-benzylidene-5-(3,4-dichlorophenyl)-1H-pyrrol-2-one |
|---|---|
| PubChem CID | 12577677 |
| Molecular Formula | C17H11Cl2NO |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | (3E)-3-benzylidene-5-(3,4-dichlorophenyl)-1H-pyrrol-2-one |
| SMILES | O=C1NC(c2ccc(Cl)c(Cl)c2)=C/C1=C\c1ccccc1 |
| InChI | InChI=1S/C17H11Cl2NO/c18-14-7-6-12(9-15(14)19)16-10-13(17(21)20-16)8-11-4-2-1-3-5-11/h1-10H,(H,20,21)/b13-8+ |
| InChIKey | SIEZYAOVSXOATH-MDWZMJQESA-N |
| XLogP | 4.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|