About 5-(3,4-dichlorophenyl)-1,3-dihydropyrrol-2-one
5-(3,4-dichlorophenyl)-1,3-dihydropyrrol-2-one (PubChem CID 12577679) has the molecular formula C10H7Cl2NO
and a molecular weight of 228.08 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-1,3-dihydropyrrol-2-one.
Molecular Properties
| Compound Name | 5-(3,4-dichlorophenyl)-1,3-dihydropyrrol-2-one |
| PubChem CID | 12577679 |
| Molecular Formula | C10H7Cl2NO |
| Molecular Weight | 228.08 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-1,3-dihydropyrrol-2-one |
| SMILES | O=C1CC=C(c2ccc(Cl)c(Cl)c2)N1 |
| InChI | InChI=1S/C10H7Cl2NO/c11-7-2-1-6(5-8(7)12)9-3-4-10(14)13-9/h1-3,5H,4H2,(H,13,14) |
| InChIKey | WFRFASKTADGKRA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.08 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(3,4-dichlorophenyl)-1,3-dihydropyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dichlorophenyl)-1,3-dihydropyrrol-2-one?
The IUPAC name of 5-(3,4-dichlorophenyl)-1,3-dihydropyrrol-2-one (CID 12577679) is 5-(3,4-dichlorophenyl)-1,3-dihydropyrrol-2-one.
What is the SMILES notation for 5-(3,4-dichlorophenyl)-1,3-dihydropyrrol-2-one?
The canonical SMILES for 5-(3,4-dichlorophenyl)-1,3-dihydropyrrol-2-one is O=C1CC=C(c2ccc(Cl)c(Cl)c2)N1.
What is the InChIKey of 5-(3,4-dichlorophenyl)-1,3-dihydropyrrol-2-one?
The InChIKey is WFRFASKTADGKRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl2NO/c11-7-2-1-6(5-8(7)12)9-3-4-10(14)13-9/h1-3,5H,4H2,(H,13,14).
What are the key properties of 5-(3,4-dichlorophenyl)-1,3-dihydropyrrol-2-one?
5-(3,4-dichlorophenyl)-1,3-dihydropyrrol-2-one has a molecular weight of 228.08 g/mol, XLogP of 2.85, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dichlorophenyl)-1,3-dihydropyrrol-2-one is sourced from PubChem (CID 12577679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).