C8H7F3O2S — CID 12578046
2,2,2-trifluoroethylsulfonylbenzene (PubChem CID 12578046) has the molecular formula C8H7F3O2S and a molecular weight of 224.20 g/mol. Its IUPAC name is 2,2,2-trifluoroethylsulfonylbenzene.
| Compound Name | 2,2,2-trifluoroethylsulfonylbenzene |
|---|---|
| PubChem CID | 12578046 |
| Molecular Formula | C8H7F3O2S |
| Molecular Weight | 224.20 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 2,2,2-trifluoroethylsulfonylbenzene |
| SMILES | O=S(=O)(CC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C8H7F3O2S/c9-8(10,11)6-14(12,13)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | ZMLUMHDKFJARJL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |