C6H7NS2 — CID 12578179
2,3-dihydro-1H-thieno[2,3-b][1,4]thiazine (PubChem CID 12578179) has the molecular formula C6H7NS2 and a molecular weight of 157.26 g/mol. Its IUPAC name is 2,3-dihydro-1H-thieno[2,3-b][1,4]thiazine.
| Compound Name | 2,3-dihydro-1H-thieno[2,3-b][1,4]thiazine |
|---|---|
| PubChem CID | 12578179 |
| Molecular Formula | C6H7NS2 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.00 |
| IUPAC Name | 2,3-dihydro-1H-thieno[2,3-b][1,4]thiazine |
| SMILES | c1cc2c(s1)SCCN2 |
| InChI | InChI=1S/C6H7NS2/c1-3-8-6-5(1)7-2-4-9-6/h1,3,7H,2,4H2 |
| InChIKey | XBSSUNBDWFNRJS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |