C6H6F6 — CID 12578250
(E)-1,1,1,5,5,5-hexafluoro-2-methylpent-2-ene (PubChem CID 12578250) has the molecular formula C6H6F6 and a molecular weight of 192.10 g/mol. Its IUPAC name is (E)-1,1,1,5,5,5-hexafluoro-2-methylpent-2-ene.
| Compound Name | (E)-1,1,1,5,5,5-hexafluoro-2-methylpent-2-ene |
|---|---|
| PubChem CID | 12578250 |
| Molecular Formula | C6H6F6 |
| Molecular Weight | 192.10 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | (E)-1,1,1,5,5,5-hexafluoro-2-methylpent-2-ene |
| SMILES | C/C(=C\CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H6F6/c1-4(6(10,11)12)2-3-5(7,8)9/h2H,3H2,1H3/b4-2+ |
| InChIKey | VIZQGAVKJWMVDX-DUXPYHPUSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.10 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|