About 5,9-dimethyldeca-1,8-dien-3-ylsulfanyl(methylsulfanyl)methanone
5,9-dimethyldeca-1,8-dien-3-ylsulfanyl(methylsulfanyl)methanone (PubChem CID 12578595) has the molecular formula C14H24OS2
and a molecular weight of 272.48 g/mol. Its IUPAC name is 5,9-dimethyldeca-1,8-dien-3-ylsulfanyl(methylsulfanyl)methanone.
Molecular Properties
| Compound Name | 5,9-dimethyldeca-1,8-dien-3-ylsulfanyl(methylsulfanyl)methanone |
| PubChem CID | 12578595 |
| Molecular Formula | C14H24OS2 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 5,9-dimethyldeca-1,8-dien-3-ylsulfanyl(methylsulfanyl)methanone |
| SMILES | C=CC(CC(C)CCC=C(C)C)SC(=O)SC |
| InChI | InChI=1S/C14H24OS2/c1-6-13(17-14(15)16-5)10-12(4)9-7-8-11(2)3/h6,8,12-13H,1,7,9-10H2,2-5H3 |
| InChIKey | WSZJEWPCEHYWNY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 5,9-dimethyldeca-1,8-dien-3-ylsulfanyl(methylsulfanyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,9-dimethyldeca-1,8-dien-3-ylsulfanyl(methylsulfanyl)methanone?
The IUPAC name of 5,9-dimethyldeca-1,8-dien-3-ylsulfanyl(methylsulfanyl)methanone (CID 12578595) is 5,9-dimethyldeca-1,8-dien-3-ylsulfanyl(methylsulfanyl)methanone.
What is the SMILES notation for 5,9-dimethyldeca-1,8-dien-3-ylsulfanyl(methylsulfanyl)methanone?
The canonical SMILES for 5,9-dimethyldeca-1,8-dien-3-ylsulfanyl(methylsulfanyl)methanone is C=CC(CC(C)CCC=C(C)C)SC(=O)SC.
What is the InChIKey of 5,9-dimethyldeca-1,8-dien-3-ylsulfanyl(methylsulfanyl)methanone?
The InChIKey is WSZJEWPCEHYWNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24OS2/c1-6-13(17-14(15)16-5)10-12(4)9-7-8-11(2)3/h6,8,12-13H,1,7,9-10H2,2-5H3.
What are the key properties of 5,9-dimethyldeca-1,8-dien-3-ylsulfanyl(methylsulfanyl)methanone?
5,9-dimethyldeca-1,8-dien-3-ylsulfanyl(methylsulfanyl)methanone has a molecular weight of 272.48 g/mol, XLogP of 5.53, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,9-dimethyldeca-1,8-dien-3-ylsulfanyl(methylsulfanyl)methanone is sourced from PubChem (CID 12578595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).